C18H25BF3NO3 — CID 164684084
N-[4,4,4-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]acetamide (PubChem CID 164684084) has the molecular formula C18H25BF3NO3 and a molecular weight of 371.21 g/mol. Its IUPAC name is N-[4,4,4-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]acetamide.
| Compound Name | N-[4,4,4-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 164684084 |
| Molecular Formula | C18H25BF3NO3 |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-[4,4,4-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]acetamide |
| SMILES | CC(=O)NC(CCC(F)(F)F)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H25BF3NO3/c1-12(24)23-15(10-11-18(20,21)22)13-6-8-14(9-7-13)19-25-16(2,3)17(4,5)26-19/h6-9,15H,10-11H2,1-5H3,(H,23,24) |
| InChIKey | RTCOVRJESBOMFB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|