C12H14F3NO — CID 177438213
(2S)-3,3,3-trifluoro-2-methyl-N-[(1R)-1-phenylethyl]propanamide (PubChem CID 177438213) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-methyl-N-[(1R)-1-phenylethyl]propanamide.
| Compound Name | (2S)-3,3,3-trifluoro-2-methyl-N-[(1R)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 177438213 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-methyl-N-[(1R)-1-phenylethyl]propanamide |
| SMILES | C[C@@H](NC(=O)[C@H](C)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H14F3NO/c1-8(12(13,14)15)11(17)16-9(2)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,16,17)/t8-,9+/m0/s1 |
| InChIKey | WMGVRDTVLFXTMR-DTWKUNHWSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |