C23H21BF9NO3 — CID 164681255
2,2,2-trifluoro-N-[(S)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 164681255) has the molecular formula C23H21BF9NO3 and a molecular weight of 541.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(S)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(S)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 164681255 |
| Molecular Formula | C23H21BF9NO3 |
| Molecular Weight | 541.22 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[(S)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC1(C)OB(c2cc([C@@H](NC(=O)C(F)(F)F)c3cccc(C(F)(F)F)c3)cc(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C23H21BF9NO3/c1-19(2)20(3,4)37-24(36-19)16-10-13(9-15(11-16)22(28,29)30)17(34-18(35)23(31,32)33)12-6-5-7-14(8-12)21(25,26)27/h5-11,17H,1-4H3,(H,34,35)/t17-/m0/s1 |
| InChIKey | ZUOASZLTNAQZAZ-KRWDZBQOSA-N |
| XLogP | 5.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.22 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|