C21H23BF3NO3 — CID 155929581
2,2,2-trifluoro-N-[(S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide (PubChem CID 155929581) has the molecular formula C21H23BF3NO3 and a molecular weight of 405.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 155929581 |
| Molecular Formula | C21H23BF3NO3 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[(S)-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]acetamide |
| SMILES | CC1(C)OB(c2cccc([C@@H](NC(=O)C(F)(F)F)c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C21H23BF3NO3/c1-19(2)20(3,4)29-22(28-19)16-12-8-11-15(13-16)17(14-9-6-5-7-10-14)26-18(27)21(23,24)25/h5-13,17H,1-4H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | JPWAMWXGKDRLOX-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|