C16H18BF6NO3 — CID 164681013
2,2,2-trifluoro-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 164681013) has the molecular formula C16H18BF6NO3 and a molecular weight of 397.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 164681013 |
| Molecular Formula | C16H18BF6NO3 |
| Molecular Weight | 397.12 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC1(C)OB(c2ccc(CNC(=O)C(F)(F)F)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C16H18BF6NO3/c1-13(2)14(3,4)27-17(26-13)10-6-5-9(11(7-10)15(18,19)20)8-24-12(25)16(21,22)23/h5-7H,8H2,1-4H3,(H,24,25) |
| InChIKey | SYOLKOBKHHISGE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.12 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|