C17H24BF2NO3 — CID 164686415
N-[3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]acetamide (PubChem CID 164686415) has the molecular formula C17H24BF2NO3 and a molecular weight of 339.19 g/mol. Its IUPAC name is N-[3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]acetamide.
| Compound Name | N-[3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 164686415 |
| Molecular Formula | C17H24BF2NO3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[3,3-difluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]acetamide |
| SMILES | CC(=O)NC(CC(F)F)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H24BF2NO3/c1-11(22)21-14(10-15(19)20)12-6-8-13(9-7-12)18-23-16(2,3)17(4,5)24-18/h6-9,14-15H,10H2,1-5H3,(H,21,22) |
| InChIKey | QXTZPWQUFWJDQW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|