C21H33BFNO3 — CID 166448080
N-[(2R)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-2,2-dimethylpropanamide (PubChem CID 166448080) has the molecular formula C21H33BFNO3 and a molecular weight of 377.31 g/mol. Its IUPAC name is N-[(2R)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2R)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 166448080 |
| Molecular Formula | C21H33BFNO3 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-[(2R)-4-(4-fluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC(CCc1ccc(F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H33BFNO3/c1-19(2,3)18(25)24-14-16(11-8-15-9-12-17(23)13-10-15)22-26-20(4,5)21(6,7)27-22/h9-10,12-13,16H,8,11,14H2,1-7H3,(H,24,25) |
| InChIKey | BFKWURDNPKLDSV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|