C21H27BF3NO3 — CID 138984983
(3Z,4R)-1,4-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methylidene]pyrrolidin-2-one (PubChem CID 138984983) has the molecular formula C21H27BF3NO3 and a molecular weight of 409.26 g/mol. Its IUPAC name is (3Z,4R)-1,4-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methylidene]pyrrolidin-2-one.
| Compound Name | (3Z,4R)-1,4-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methylidene]pyrrolidin-2-one |
|---|---|
| PubChem CID | 138984983 |
| Molecular Formula | C21H27BF3NO3 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (3Z,4R)-1,4-dimethyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methylidene]pyrrolidin-2-one |
| SMILES | CN1C[C@](C)(CB2OC(C)(C)C(C)(C)O2)/C(=C/c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C21H27BF3NO3/c1-18(2)19(3,4)29-22(28-18)12-20(5)13-26(6)17(27)16(20)11-14-7-9-15(10-8-14)21(23,24)25/h7-11H,12-13H2,1-6H3/b16-11+/t20-/m0/s1 |
| InChIKey | VQKZBNCKHMOCDQ-PRDNPTHXSA-N |
| XLogP | 4.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|