C26H29BF3NO3 — CID 138984981
(3Z,4S)-3-benzylidene-1-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 138984981) has the molecular formula C26H29BF3NO3 and a molecular weight of 471.33 g/mol. Its IUPAC name is (3Z,4S)-3-benzylidene-1-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (3Z,4S)-3-benzylidene-1-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 138984981 |
| Molecular Formula | C26H29BF3NO3 |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (3Z,4S)-3-benzylidene-1-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CN1C[C@@](CB2OC(C)(C)C(C)(C)O2)(c2ccc(C(F)(F)F)cc2)/C(=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C26H29BF3NO3/c1-23(2)24(3,4)34-27(33-23)16-25(19-11-13-20(14-12-19)26(28,29)30)17-31(5)22(32)21(25)15-18-9-7-6-8-10-18/h6-15H,16-17H2,1-5H3/b21-15+/t25-/m0/s1 |
| InChIKey | PUMAKAFZYMGEDF-WZLQQZPBSA-N |
| XLogP | 5.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|