C21H19F3N2O — CID 138976558
N-tert-butyl-2,2,2-trifluoro-N-(3-phenylquinolin-2-yl)acetamide (PubChem CID 138976558) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is N-tert-butyl-2,2,2-trifluoro-N-(3-phenylquinolin-2-yl)acetamide.
| Compound Name | N-tert-butyl-2,2,2-trifluoro-N-(3-phenylquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 138976558 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-tert-butyl-2,2,2-trifluoro-N-(3-phenylquinolin-2-yl)acetamide |
| SMILES | CC(C)(C)N(C(=O)C(F)(F)F)c1nc2ccccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C21H19F3N2O/c1-20(2,3)26(19(27)21(22,23)24)18-16(14-9-5-4-6-10-14)13-15-11-7-8-12-17(15)25-18/h4-13H,1-3H3 |
| InChIKey | FVFUSXJUMYWJBO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |