C30H56O6Si2 — CID 138976733
(1S,4S,7S,9S,12S,15S)-4,12-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,11-dioxatricyclo[13.1.0.07,9]hexadecane-2,10-dione (PubChem CID 138976733) has the molecular formula C30H56O6Si2 and a molecular weight of 568.94 g/mol. Its IUPAC name is (1S,4S,7S,9S,12S,15S)-4,12-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,11-dioxatricyclo[13.1.0.07,9]hexadecane-2,10-dione.
| Compound Name | (1S,4S,7S,9S,12S,15S)-4,12-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,11-dioxatricyclo[13.1.0.07,9]hexadecane-2,10-dione |
|---|---|
| PubChem CID | 138976733 |
| Molecular Formula | C30H56O6Si2 |
| Molecular Weight | 568.94 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | (1S,4S,7S,9S,12S,15S)-4,12-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,11-dioxatricyclo[13.1.0.07,9]hexadecane-2,10-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1CC[C@H]2C[C@@H]2C(=O)O[C@H](CCO[Si](C)(C)C(C)(C)C)CC[C@H]2C[C@@H]2C(=O)O1 |
| InChI | InChI=1S/C30H56O6Si2/c1-29(2,3)37(7,8)33-17-15-23-13-11-21-19-26(21)28(32)36-24(14-12-22-20-25(22)27(31)35-23)16-18-34-38(9,10)30(4,5)6/h21-26H,11-20H2,1-10H3/t21-,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | PKVCPKDJRRBJLM-FRSCJGFNSA-N |
| XLogP | 7.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.94 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|