C20H39NO4 — CID 138976835
tert-butyl (4R)-4-[(1R)-1-hydroxydecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 138976835) has the molecular formula C20H39NO4 and a molecular weight of 357.54 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1R)-1-hydroxydecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1R)-1-hydroxydecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 138976835 |
| Molecular Formula | C20H39NO4 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | tert-butyl (4R)-4-[(1R)-1-hydroxydecyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCCCC[C@@H](O)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39NO4/c1-7-8-9-10-11-12-13-14-17(22)16-15-24-20(5,6)21(16)18(23)25-19(2,3)4/h16-17,22H,7-15H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | JQHGFLAWYPGSPA-IAGOWNOFSA-N |
| XLogP | 4.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|