C23H32O4 — CID 138978791
[(1S,4aS,10aR)-8-methoxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate (PubChem CID 138978791) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(1S,4aS,10aR)-8-methoxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate.
| Compound Name | [(1S,4aS,10aR)-8-methoxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 138978791 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1S,4aS,10aR)-8-methoxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate |
| SMILES | COc1c(C(C)C)ccc2c1C(=O)C[C@H]1[C@@](C)(COC(C)=O)CCC[C@]21C |
| InChI | InChI=1S/C23H32O4/c1-14(2)16-8-9-17-20(21(16)26-6)18(25)12-19-22(4,13-27-15(3)24)10-7-11-23(17,19)5/h8-9,14,19H,7,10-13H2,1-6H3/t19-,22+,23+/m0/s1 |
| InChIKey | VKYSXMHFMKHCBP-WWPVKYPJSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |