C26H34O7 — CID 102052780
[(1R,4aS,10R,10aR)-6,10-diacetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate (PubChem CID 102052780) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is [(1R,4aS,10R,10aR)-6,10-diacetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate.
| Compound Name | [(1R,4aS,10R,10aR)-6,10-diacetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 102052780 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [(1R,4aS,10R,10aR)-6,10-diacetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)CCC[C@]2(C)c3cc(OC(C)=O)c(C(C)C)cc3C(=O)[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C26H34O7/c1-14(2)18-11-19-20(12-21(18)32-16(4)28)26(7)10-8-9-25(6,13-31-15(3)27)24(26)23(22(19)30)33-17(5)29/h11-12,14,23-24H,8-10,13H2,1-7H3/t23-,24-,25-,26+/m0/s1 |
| InChIKey | PABGUBVWSQUPKP-ASDGIDEWSA-N |
| XLogP | 4.49 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|