C21H28O7 — CID 138979680
1-O-methyl 8-O-prop-2-enyl (E,6R,7S)-6-ethenyl-7-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-2,6-dimethyloct-2-enedioate (PubChem CID 138979680) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-O-methyl 8-O-prop-2-enyl (E,6R,7S)-6-ethenyl-7-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-2,6-dimethyloct-2-enedioate.
| Compound Name | 1-O-methyl 8-O-prop-2-enyl (E,6R,7S)-6-ethenyl-7-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-2,6-dimethyloct-2-enedioate |
|---|---|
| PubChem CID | 138979680 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-O-methyl 8-O-prop-2-enyl (E,6R,7S)-6-ethenyl-7-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-2,6-dimethyloct-2-enedioate |
| SMILES | C=CCOC(=O)[C@H]([C@@H]1OC(O)C=CC1=O)[C@@](C)(C=C)CC/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C21H28O7/c1-6-13-27-20(25)17(18-15(22)10-11-16(23)28-18)21(4,7-2)12-8-9-14(3)19(24)26-5/h6-7,9-11,16-18,23H,1-2,8,12-13H2,3-5H3/b14-9+/t16?,17-,18+,21-/m0/s1 |
| InChIKey | TZPSSOUXFOSKPA-TXRWNSHXSA-N |
| XLogP | 2.27 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|