C21H30O6 — CID 138979976
prop-2-enyl (E,2S,3R)-3-ethenyl-8-hydroxy-2-[(6S)-2-methoxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate (PubChem CID 138979976) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is prop-2-enyl (E,2S,3R)-3-ethenyl-8-hydroxy-2-[(6S)-2-methoxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate.
| Compound Name | prop-2-enyl (E,2S,3R)-3-ethenyl-8-hydroxy-2-[(6S)-2-methoxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 138979976 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | prop-2-enyl (E,2S,3R)-3-ethenyl-8-hydroxy-2-[(6S)-2-methoxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate |
| SMILES | C=CCOC(=O)[C@H]([C@@H]1OC(OC)C=CC1=O)[C@@](C)(C=C)CC/C=C(\C)CO |
| InChI | InChI=1S/C21H30O6/c1-6-13-26-20(24)18(19-16(23)10-11-17(25-5)27-19)21(4,7-2)12-8-9-15(3)14-22/h6-7,9-11,17-19,22H,1-2,8,12-14H2,3-5H3/b15-9+/t17?,18-,19+,21-/m0/s1 |
| InChIKey | PXQJRTKTEQMWPX-LHGCPWKYSA-N |
| XLogP | 2.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|