C20H28O5 — CID 138979975
prop-2-enyl (2S,3S)-3-ethenyl-2-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate (PubChem CID 138979975) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is prop-2-enyl (2S,3S)-3-ethenyl-2-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate.
| Compound Name | prop-2-enyl (2S,3S)-3-ethenyl-2-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 138979975 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | prop-2-enyl (2S,3S)-3-ethenyl-2-[(6S)-2-hydroxy-5-oxo-2H-pyran-6-yl]-3,7-dimethyloct-6-enoate |
| SMILES | C=CCOC(=O)[C@H]([C@@H]1OC(O)C=CC1=O)[C@](C)(C=C)CCC=C(C)C |
| InChI | InChI=1S/C20H28O5/c1-6-13-24-19(23)17(18-15(21)10-11-16(22)25-18)20(5,7-2)12-8-9-14(3)4/h6-7,9-11,16-18,22H,1-2,8,12-13H2,3-5H3/t16?,17-,18+,20+/m0/s1 |
| InChIKey | WWDTZFFTCNEOEQ-LENZUNBYSA-N |
| XLogP | 3.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|