About 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline
4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline (PubChem CID 138980430) has the molecular formula C19H21N
and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline.
Molecular Properties
| Compound Name | 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline |
| PubChem CID | 138980430 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline |
| SMILES | C(/C=C/C1CCCCC1)=C\c1ccnc2ccccc12 |
| InChI | InChI=1S/C19H21N/c1-2-8-16(9-3-1)10-4-5-11-17-14-15-20-19-13-7-6-12-18(17)19/h4-7,10-16H,1-3,8-9H2/b10-4+,11-5+ |
| InChIKey | KBYUXQFPZYTAOY-ZVSIBQGLSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline?
The IUPAC name of 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline (CID 138980430) is 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline.
What is the SMILES notation for 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline?
The canonical SMILES for 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline is C(/C=C/C1CCCCC1)=C\c1ccnc2ccccc12.
What is the InChIKey of 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline?
The InChIKey is KBYUXQFPZYTAOY-ZVSIBQGLSA-N. The full InChI is InChI=1S/C19H21N/c1-2-8-16(9-3-1)10-4-5-11-17-14-15-20-19-13-7-6-12-18(17)19/h4-7,10-16H,1-3,8-9H2/b10-4+,11-5+.
What are the key properties of 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline?
4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline has a molecular weight of 263.38 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline is sourced from PubChem (CID 138980430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).