C19H21N — CID 138980430
4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline (PubChem CID 138980430) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline.
| Compound Name | 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline |
|---|---|
| PubChem CID | 138980430 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-[(1E,3E)-4-cyclohexylbuta-1,3-dienyl]quinoline |
| SMILES | C(/C=C/C1CCCCC1)=C\c1ccnc2ccccc12 |
| InChI | InChI=1S/C19H21N/c1-2-8-16(9-3-1)10-4-5-11-17-14-15-20-19-13-7-6-12-18(17)19/h4-7,10-16H,1-3,8-9H2/b10-4+,11-5+ |
| InChIKey | KBYUXQFPZYTAOY-ZVSIBQGLSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|