C31H41NO4 — CID 138981177
tert-butyl (2S)-2-[(E,1S)-1-[[(1S)-1-phenylethyl]-phenylmethoxycarbonylamino]but-2-enyl]hept-6-enoate (PubChem CID 138981177) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E,1S)-1-[[(1S)-1-phenylethyl]-phenylmethoxycarbonylamino]but-2-enyl]hept-6-enoate.
| Compound Name | tert-butyl (2S)-2-[(E,1S)-1-[[(1S)-1-phenylethyl]-phenylmethoxycarbonylamino]but-2-enyl]hept-6-enoate |
|---|---|
| PubChem CID | 138981177 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | tert-butyl (2S)-2-[(E,1S)-1-[[(1S)-1-phenylethyl]-phenylmethoxycarbonylamino]but-2-enyl]hept-6-enoate |
| SMILES | C=CCCC[C@H](C(=O)OC(C)(C)C)[C@H](/C=C/C)N(C(=O)OCc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C31H41NO4/c1-7-9-12-22-27(29(33)36-31(4,5)6)28(17-8-2)32(24(3)26-20-15-11-16-21-26)30(34)35-23-25-18-13-10-14-19-25/h7-8,10-11,13-21,24,27-28H,1,9,12,22-23H2,2-6H3/b17-8+/t24-,27-,28-/m0/s1 |
| InChIKey | ZKXJYLFOOBFTEY-JLIXRFAVSA-N |
| XLogP | 7.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|