C21H25NO6 — CID 138982138
trimethyl (1S,2S,3R,8S)-3-[(E)-2-phenylethenyl]-1,2,5,6,7,8-hexahydropyrrolizine-1,2,3-tricarboxylate (PubChem CID 138982138) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is trimethyl (1S,2S,3R,8S)-3-[(E)-2-phenylethenyl]-1,2,5,6,7,8-hexahydropyrrolizine-1,2,3-tricarboxylate.
| Compound Name | trimethyl (1S,2S,3R,8S)-3-[(E)-2-phenylethenyl]-1,2,5,6,7,8-hexahydropyrrolizine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 138982138 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | trimethyl (1S,2S,3R,8S)-3-[(E)-2-phenylethenyl]-1,2,5,6,7,8-hexahydropyrrolizine-1,2,3-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2CCCN2[C@@](/C=C/c2ccccc2)(C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H25NO6/c1-26-18(23)16-15-10-7-13-22(15)21(20(25)28-3,17(16)19(24)27-2)12-11-14-8-5-4-6-9-14/h4-6,8-9,11-12,15-17H,7,10,13H2,1-3H3/b12-11+/t15-,16+,17+,21+/m0/s1 |
| InChIKey | HZQWZUFYOPGKGF-RSQKAEJKSA-N |
| XLogP | 1.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|