C17H11NO2 — CID 138982155
11-aminonaphtho[1,2-c]isochromen-6-one (PubChem CID 138982155) has the molecular formula C17H11NO2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 11-aminonaphtho[1,2-c]isochromen-6-one.
| Compound Name | 11-aminonaphtho[1,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 138982155 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 11-aminonaphtho[1,2-c]isochromen-6-one |
| SMILES | Nc1cc2ccccc2c2oc(=O)c3ccccc3c12 |
| InChI | InChI=1S/C17H11NO2/c18-14-9-10-5-1-2-6-11(10)16-15(14)12-7-3-4-8-13(12)17(19)20-16/h1-9H,18H2 |
| InChIKey | HGUPBZUUJUIAIC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|