C14H13NO3 — CID 71598409
5-amino-9-methoxy-3,4-dihydrobenzo[h]chromen-2-one (PubChem CID 71598409) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 5-amino-9-methoxy-3,4-dihydrobenzo[h]chromen-2-one.
| Compound Name | 5-amino-9-methoxy-3,4-dihydrobenzo[h]chromen-2-one |
|---|---|
| PubChem CID | 71598409 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 5-amino-9-methoxy-3,4-dihydrobenzo[h]chromen-2-one |
| SMILES | COc1ccc2cc(N)c3c(c2c1)OC(=O)CC3 |
| InChI | InChI=1S/C14H13NO3/c1-17-9-3-2-8-6-12(15)10-4-5-13(16)18-14(10)11(8)7-9/h2-3,6-7H,4-5,15H2,1H3 |
| InChIKey | GJRIECBYJRFPCW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|