C13H13NO2 — CID 102501424
6-amino-7,8,9,10-tetrahydrobenzo[f]chromen-3-one (PubChem CID 102501424) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 6-amino-7,8,9,10-tetrahydrobenzo[f]chromen-3-one.
| Compound Name | 6-amino-7,8,9,10-tetrahydrobenzo[f]chromen-3-one |
|---|---|
| PubChem CID | 102501424 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 6-amino-7,8,9,10-tetrahydrobenzo[f]chromen-3-one |
| SMILES | Nc1cc2oc(=O)ccc2c2c1CCCC2 |
| InChI | InChI=1S/C13H13NO2/c14-11-7-12-10(5-6-13(15)16-12)8-3-1-2-4-9(8)11/h5-7H,1-4,14H2 |
| InChIKey | GPMSZCHWBYMAQO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|