C26H20N4 — CID 138982234
2-[3,4-bis(4-methyl-2-pyridinyl)naphthalen-2-yl]pyrimidine (PubChem CID 138982234) has the molecular formula C26H20N4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[3,4-bis(4-methyl-2-pyridinyl)naphthalen-2-yl]pyrimidine.
| Compound Name | 2-[3,4-bis(4-methyl-2-pyridinyl)naphthalen-2-yl]pyrimidine |
|---|---|
| PubChem CID | 138982234 |
| Molecular Formula | C26H20N4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[3,4-bis(4-methyl-2-pyridinyl)naphthalen-2-yl]pyrimidine |
| SMILES | Cc1ccnc(-c2c(-c3ncccn3)cc3ccccc3c2-c2cc(C)ccn2)c1 |
| InChI | InChI=1S/C26H20N4/c1-17-8-12-27-22(14-17)24-20-7-4-3-6-19(20)16-21(26-29-10-5-11-30-26)25(24)23-15-18(2)9-13-28-23/h3-16H,1-2H3 |
| InChIKey | HZRNQCHCHLMRFU-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |