C21H22O3 — CID 138982358
4-acetyl-2-methyl-1,3-diphenylhexane-1,5-dione (PubChem CID 138982358) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-acetyl-2-methyl-1,3-diphenylhexane-1,5-dione.
| Compound Name | 4-acetyl-2-methyl-1,3-diphenylhexane-1,5-dione |
|---|---|
| PubChem CID | 138982358 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 4-acetyl-2-methyl-1,3-diphenylhexane-1,5-dione |
| SMILES | CC(=O)C(C(C)=O)C(c1ccccc1)C(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22O3/c1-14(21(24)18-12-8-5-9-13-18)19(17-10-6-4-7-11-17)20(15(2)22)16(3)23/h4-14,19-20H,1-3H3 |
| InChIKey | DRTVKQNUIRLIRZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|