C14H18O4 — CID 138982626
[(1E)-1-[(3aR,7aS)-3a-methoxy-6-oxo-2,3,7,7a-tetrahydroinden-1-ylidene]ethyl] acetate (PubChem CID 138982626) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is [(1E)-1-[(3aR,7aS)-3a-methoxy-6-oxo-2,3,7,7a-tetrahydroinden-1-ylidene]ethyl] acetate.
| Compound Name | [(1E)-1-[(3aR,7aS)-3a-methoxy-6-oxo-2,3,7,7a-tetrahydroinden-1-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 138982626 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(1E)-1-[(3aR,7aS)-3a-methoxy-6-oxo-2,3,7,7a-tetrahydroinden-1-ylidene]ethyl] acetate |
| SMILES | CO[C@]12C=CC(=O)C[C@H]1/C(=C(\C)OC(C)=O)CC2 |
| InChI | InChI=1S/C14H18O4/c1-9(18-10(2)15)12-5-7-14(17-3)6-4-11(16)8-13(12)14/h4,6,13H,5,7-8H2,1-3H3/b12-9+/t13-,14-/m0/s1 |
| InChIKey | XQIIADOLWYTIRS-ZJTSMVRJSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|