C24H38O6 — CID 54410813
methyl 3-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate (PubChem CID 54410813) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is methyl 3-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate.
| Compound Name | methyl 3-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 54410813 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | methyl 3-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate |
| SMILES | CCCOC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCC(=CC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C24H38O6/c1-6-16-29-24(3,4)15-9-10-19-13-14-22(26)21(19)12-8-7-11-20(30-18(2)25)17-23(27)28-5/h9-10,17,19,21H,6-8,11-16H2,1-5H3/t19-,21+/m0/s1 |
| InChIKey | VTZKBKBMZKGKLH-PZJWPPBQSA-N |
| XLogP | 4.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|