C17H26O4 — CID 134901871
methyl (Z)-4-[(1S,2S)-2-but-3-enyl-3,3-dimethyl-5-oxocyclopentyl]-3-methoxybut-2-enoate (PubChem CID 134901871) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl (Z)-4-[(1S,2S)-2-but-3-enyl-3,3-dimethyl-5-oxocyclopentyl]-3-methoxybut-2-enoate.
| Compound Name | methyl (Z)-4-[(1S,2S)-2-but-3-enyl-3,3-dimethyl-5-oxocyclopentyl]-3-methoxybut-2-enoate |
|---|---|
| PubChem CID | 134901871 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl (Z)-4-[(1S,2S)-2-but-3-enyl-3,3-dimethyl-5-oxocyclopentyl]-3-methoxybut-2-enoate |
| SMILES | C=CCC[C@H]1[C@H](C/C(=C/C(=O)OC)OC)C(=O)CC1(C)C |
| InChI | InChI=1S/C17H26O4/c1-6-7-8-14-13(15(18)11-17(14,2)3)9-12(20-4)10-16(19)21-5/h6,10,13-14H,1,7-9,11H2,2-5H3/b12-10-/t13-,14-/m0/s1 |
| InChIKey | FFHLGPSBPQUBGJ-ZFRJQFIBSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|