C16H22O4 — CID 135054205
dimethyl (3aS,8aR)-3a-methyl-8-methylidene-1,2,3,4,7,8a-hexahydroazulene-2,5-dicarboxylate (PubChem CID 135054205) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is dimethyl (3aS,8aR)-3a-methyl-8-methylidene-1,2,3,4,7,8a-hexahydroazulene-2,5-dicarboxylate.
| Compound Name | dimethyl (3aS,8aR)-3a-methyl-8-methylidene-1,2,3,4,7,8a-hexahydroazulene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 135054205 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | dimethyl (3aS,8aR)-3a-methyl-8-methylidene-1,2,3,4,7,8a-hexahydroazulene-2,5-dicarboxylate |
| SMILES | C=C1CC=C(C(=O)OC)C[C@]2(C)CC(C(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C16H22O4/c1-10-5-6-11(14(17)19-3)8-16(2)9-12(7-13(10)16)15(18)20-4/h6,12-13H,1,5,7-9H2,2-4H3/t12?,13-,16-/m1/s1 |
| InChIKey | UFYXZWJBKVAGGY-LLQOJDTPSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|