C17H24O7Si — CID 138982870
[(3R)-3,4-diacetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 138982870) has the molecular formula C17H24O7Si and a molecular weight of 368.46 g/mol. Its IUPAC name is [(3R)-3,4-diacetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(3R)-3,4-diacetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138982870 |
| Molecular Formula | C17H24O7Si |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(3R)-3,4-diacetyloxy-6-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(C#C[Si](C)(C)C)C=C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H24O7Si/c1-11(18)21-10-16-17(23-13(3)20)15(22-12(2)19)9-14(24-16)7-8-25(4,5)6/h9,14,16-17H,10H2,1-6H3/t14?,16?,17-/m0/s1 |
| InChIKey | HZEJRUBCRWSVJU-PREGVCBESA-N |
| XLogP | 1.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|