C26H48O4Si — CID 138983040
[(3S,4S)-3-methyl-4-[(Z)-3-[(1S,2R)-2-methylcyclopropyl]but-2-enoxy]-6-tri(propan-2-yl)silyloxyhex-1-en-2-yl] acetate (PubChem CID 138983040) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is [(3S,4S)-3-methyl-4-[(Z)-3-[(1S,2R)-2-methylcyclopropyl]but-2-enoxy]-6-tri(propan-2-yl)silyloxyhex-1-en-2-yl] acetate.
| Compound Name | [(3S,4S)-3-methyl-4-[(Z)-3-[(1S,2R)-2-methylcyclopropyl]but-2-enoxy]-6-tri(propan-2-yl)silyloxyhex-1-en-2-yl] acetate |
|---|---|
| PubChem CID | 138983040 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | [(3S,4S)-3-methyl-4-[(Z)-3-[(1S,2R)-2-methylcyclopropyl]but-2-enoxy]-6-tri(propan-2-yl)silyloxyhex-1-en-2-yl] acetate |
| SMILES | C=C(OC(C)=O)[C@@H](C)[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)OC/C=C(/C)[C@H]1C[C@H]1C |
| InChI | InChI=1S/C26H48O4Si/c1-17(2)31(18(3)4,19(5)6)29-15-13-26(22(9)23(10)30-24(11)27)28-14-12-20(7)25-16-21(25)8/h12,17-19,21-22,25-26H,10,13-16H2,1-9,11H3/b20-12-/t21-,22-,25-,26+/m1/s1 |
| InChIKey | HOUWQTYWCYKEMY-CWMPGAGNSA-N |
| XLogP | 7.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|