C22H42O3Si — CID 177450196
[(4S,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-2-methylideneundec-6-enyl] acetate (PubChem CID 177450196) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is [(4S,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-2-methylideneundec-6-enyl] acetate.
| Compound Name | [(4S,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-2-methylideneundec-6-enyl] acetate |
|---|---|
| PubChem CID | 177450196 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [(4S,5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-2-methylideneundec-6-enyl] acetate |
| SMILES | C=C(COC(C)=O)C[C@H](C)[C@H](C=C[C@@H](C)CCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-11-12-17(2)13-14-21(25-26(9,10)22(6,7)8)19(4)15-18(3)16-24-20(5)23/h13-14,17,19,21H,3,11-12,15-16H2,1-2,4-10H3/t17-,19-,21-/m0/s1 |
| InChIKey | IOYSGHORNUSERV-CUWPLCDZSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|