C21H36O3Si — CID 164674453
[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylcyclohexen-1-yl]methyl (3R)-3-methylpent-4-enoate (PubChem CID 164674453) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylcyclohexen-1-yl]methyl (3R)-3-methylpent-4-enoate.
| Compound Name | [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylcyclohexen-1-yl]methyl (3R)-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 164674453 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylcyclohexen-1-yl]methyl (3R)-3-methylpent-4-enoate |
| SMILES | C=C[C@@H]1C=C(COC(=O)C[C@@H](C)C=C)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-9-16(3)13-20(22)23-15-17-11-12-19(18(10-2)14-17)24-25(7,8)21(4,5)6/h9-10,14,16,18-19H,1-2,11-13,15H2,3-8H3/t16-,18+,19+/m0/s1 |
| InChIKey | NLJZRLQPJXYRJV-QXAKKESOSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|