C27H56O4Si2 — CID 11730808
[(Z,4R,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylhept-2-enyl] 2,2-dimethylpropanoate (PubChem CID 11730808) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is [(Z,4R,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylhept-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(Z,4R,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylhept-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11730808 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | [(Z,4R,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylhept-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H56O4Si2/c1-20(18-29-24(28)25(4,5)6)17-21(2)23(31-33(15,16)27(10,11)12)22(3)19-30-32(13,14)26(7,8)9/h17,21-23H,18-19H2,1-16H3/b20-17-/t21-,22-,23+/m1/s1 |
| InChIKey | ODERKZSDOKZGAP-HVFIHJOKSA-N |
| XLogP | 8.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|