C20H18BrNO4 — CID 138983945
methyl 3-bromo-2-hydroxy-3-phenyl-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]propanoate (PubChem CID 138983945) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is methyl 3-bromo-2-hydroxy-3-phenyl-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]propanoate.
| Compound Name | methyl 3-bromo-2-hydroxy-3-phenyl-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]propanoate |
|---|---|
| PubChem CID | 138983945 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | methyl 3-bromo-2-hydroxy-3-phenyl-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]propanoate |
| SMILES | COC(=O)C(O)(Cc1cnc(-c2ccccc2)o1)C(Br)c1ccccc1 |
| InChI | InChI=1S/C20H18BrNO4/c1-25-19(23)20(24,17(21)14-8-4-2-5-9-14)12-16-13-22-18(26-16)15-10-6-3-7-11-15/h2-11,13,17,24H,12H2,1H3 |
| InChIKey | CSAILIMRBKEZOJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|