C17H21NO3Si — CID 122373666
(2R)-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]-4-trimethylsilylbut-3-yne-1,2-diol (PubChem CID 122373666) has the molecular formula C17H21NO3Si and a molecular weight of 315.44 g/mol. Its IUPAC name is (2R)-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]-4-trimethylsilylbut-3-yne-1,2-diol.
| Compound Name | (2R)-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]-4-trimethylsilylbut-3-yne-1,2-diol |
|---|---|
| PubChem CID | 122373666 |
| Molecular Formula | C17H21NO3Si |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2R)-2-[(2-phenyl-1,3-oxazol-5-yl)methyl]-4-trimethylsilylbut-3-yne-1,2-diol |
| SMILES | C[Si](C)(C)C#C[C@@](O)(CO)Cc1cnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H21NO3Si/c1-22(2,3)10-9-17(20,13-19)11-15-12-18-16(21-15)14-7-5-4-6-8-14/h4-8,12,19-20H,11,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | MJLZLLNNFDGTCX-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|