C11H7ClF3NO — CID 57076907
2-(4-chlorophenyl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole (PubChem CID 57076907) has the molecular formula C11H7ClF3NO and a molecular weight of 261.63 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole.
| Compound Name | 2-(4-chlorophenyl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 57076907 |
| Molecular Formula | C11H7ClF3NO |
| Molecular Weight | 261.63 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(2,2,2-trifluoroethyl)-1,3-oxazole |
| SMILES | FC(F)(F)Cc1cnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C11H7ClF3NO/c12-8-3-1-7(2-4-8)10-16-6-9(17-10)5-11(13,14)15/h1-4,6H,5H2 |
| InChIKey | LLUWVDNXWUWFDX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |