C19H14BrFN4O3 — CID 138984635
5-bromo-1-[[1-[(2-fluoro-5-methoxyphenyl)methyl]triazol-4-yl]methyl]indole-2,3-dione (PubChem CID 138984635) has the molecular formula C19H14BrFN4O3 and a molecular weight of 445.25 g/mol. Its IUPAC name is 5-bromo-1-[[1-[(2-fluoro-5-methoxyphenyl)methyl]triazol-4-yl]methyl]indole-2,3-dione.
| Compound Name | 5-bromo-1-[[1-[(2-fluoro-5-methoxyphenyl)methyl]triazol-4-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 138984635 |
| Molecular Formula | C19H14BrFN4O3 |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 5-bromo-1-[[1-[(2-fluoro-5-methoxyphenyl)methyl]triazol-4-yl]methyl]indole-2,3-dione |
| SMILES | COc1ccc(F)c(Cn2cc(CN3C(=O)C(=O)c4cc(Br)ccc43)nn2)c1 |
| InChI | InChI=1S/C19H14BrFN4O3/c1-28-14-3-4-16(21)11(6-14)8-24-9-13(22-23-24)10-25-17-5-2-12(20)7-15(17)18(26)19(25)27/h2-7,9H,8,10H2,1H3 |
| InChIKey | YRRBIMUNDFAXSH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|