C37H36O2 — CID 138984845
(8R,9S,13S,14S)-3-[5-[(E,1R)-1,3-diphenylprop-2-enyl]furan-2-yl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 138984845) has the molecular formula C37H36O2 and a molecular weight of 512.69 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-[5-[(E,1R)-1,3-diphenylprop-2-enyl]furan-2-yl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-[5-[(E,1R)-1,3-diphenylprop-2-enyl]furan-2-yl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 138984845 |
| Molecular Formula | C37H36O2 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | (8R,9S,13S,14S)-3-[5-[(E,1R)-1,3-diphenylprop-2-enyl]furan-2-yl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(-c5ccc([C@H](/C=C/c6ccccc6)c6ccccc6)o5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C37H36O2/c1-37-23-22-31-29-16-14-28(24-27(29)13-17-32(31)33(37)18-21-36(37)38)34-19-20-35(39-34)30(26-10-6-3-7-11-26)15-12-25-8-4-2-5-9-25/h2-12,14-16,19-20,24,30-33H,13,17-18,21-23H2,1H3/b15-12+/t30-,31-,32-,33+,37+/m1/s1 |
| InChIKey | NLFRKOSMVBGXBC-XJDRDKPSSA-N |
| XLogP | 9.22 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |