C45H27N4- — CID 138984937
CID 138984937 (PubChem CID 138984937) has the molecular formula C45H27N4- and a molecular weight of 623.74 g/mol.
| Compound Name | CID 138984937 |
|---|---|
| PubChem CID | 138984937 |
| Molecular Formula | C45H27N4- |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | — |
| SMILES | [c-]1c2c3cnc2c(-c2ccccc2)c2nc(c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc(c3-c3ccccc3)n15)C=C4)C=C2 |
| InChI | InChI=1S/C45H27N4/c1-5-13-29(14-6-1)41-33-27-46-45-34(33)28-49-39(41)25-26-40(49)43(31-17-9-3-10-18-31)37-23-21-35(47-37)42(30-15-7-2-8-16-30)36-22-24-38(48-36)44(45)32-19-11-4-12-20-32/h1-27H/q-1/b42-35-,42-36-,43-37-,43-40-,44-38-,45-44+ |
| InChIKey | YCCOHKAFBKSOFJ-UPAYZDSCSA-N |
| XLogP | 10.99 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|