C24H28N4O4 — CID 138990498
(14aR)-N-cyclopropyl-10-(3-methoxyphenyl)-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide (PubChem CID 138990498) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (14aR)-N-cyclopropyl-10-(3-methoxyphenyl)-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide.
| Compound Name | (14aR)-N-cyclopropyl-10-(3-methoxyphenyl)-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide |
|---|---|
| PubChem CID | 138990498 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (14aR)-N-cyclopropyl-10-(3-methoxyphenyl)-7-oxo-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide |
| SMILES | COc1cccc(-c2ccc3c(c2)NC(=O)CN2CCN(C(=O)NC4CC4)C[C@@H]2CO3)c1 |
| InChI | InChI=1S/C24H28N4O4/c1-31-20-4-2-3-16(11-20)17-5-8-22-21(12-17)26-23(29)14-27-9-10-28(13-19(27)15-32-22)24(30)25-18-6-7-18/h2-5,8,11-12,18-19H,6-7,9-10,13-15H2,1H3,(H,25,30)(H,26,29)/t19-/m1/s1 |
| InChIKey | MDYKDDIXRBNUJX-LJQANCHMSA-N |
| XLogP | 2.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |