C26H22ClF2N3O3 — CID 138990447
(14aR)-2-(3-chlorobenzoyl)-10-(2,4-difluorophenyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one (PubChem CID 138990447) has the molecular formula C26H22ClF2N3O3 and a molecular weight of 497.93 g/mol. Its IUPAC name is (14aR)-2-(3-chlorobenzoyl)-10-(2,4-difluorophenyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one.
| Compound Name | (14aR)-2-(3-chlorobenzoyl)-10-(2,4-difluorophenyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
|---|---|
| PubChem CID | 138990447 |
| Molecular Formula | C26H22ClF2N3O3 |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (14aR)-2-(3-chlorobenzoyl)-10-(2,4-difluorophenyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
| SMILES | O=C1CN2CCN(C(=O)c3cccc(Cl)c3)C[C@@H]2COc2ccc(-c3ccc(F)cc3F)cc2N1 |
| InChI | InChI=1S/C26H22ClF2N3O3/c27-18-3-1-2-17(10-18)26(34)32-9-8-31-14-25(33)30-23-11-16(21-6-5-19(28)12-22(21)29)4-7-24(23)35-15-20(31)13-32/h1-7,10-12,20H,8-9,13-15H2,(H,30,33)/t20-/m1/s1 |
| InChIKey | FCBNCPHJKDIXDW-HXUWFJFHSA-N |
| XLogP | 4.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |