C24H22ClFN4O4S — CID 138990351
(14aR)-2-(3-chlorophenyl)sulfonyl-10-(2-fluoro-3-pyridinyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one (PubChem CID 138990351) has the molecular formula C24H22ClFN4O4S and a molecular weight of 516.98 g/mol. Its IUPAC name is (14aR)-2-(3-chlorophenyl)sulfonyl-10-(2-fluoro-3-pyridinyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one.
| Compound Name | (14aR)-2-(3-chlorophenyl)sulfonyl-10-(2-fluoro-3-pyridinyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
|---|---|
| PubChem CID | 138990351 |
| Molecular Formula | C24H22ClFN4O4S |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (14aR)-2-(3-chlorophenyl)sulfonyl-10-(2-fluoro-3-pyridinyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
| SMILES | O=C1CN2CCN(S(=O)(=O)c3cccc(Cl)c3)C[C@@H]2COc2ccc(-c3cccnc3F)cc2N1 |
| InChI | InChI=1S/C24H22ClFN4O4S/c25-17-3-1-4-19(12-17)35(32,33)30-10-9-29-14-23(31)28-21-11-16(20-5-2-8-27-24(20)26)6-7-22(21)34-15-18(29)13-30/h1-8,11-12,18H,9-10,13-15H2,(H,28,31)/t18-/m1/s1 |
| InChIKey | BXRJXMDNRVKKMY-GOSISDBHSA-N |
| XLogP | 3.25 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|