C26H24F2N4O3 — CID 138990463
(14aR)-10-(2,4-difluorophenyl)-7-oxo-N-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide (PubChem CID 138990463) has the molecular formula C26H24F2N4O3 and a molecular weight of 478.50 g/mol. Its IUPAC name is (14aR)-10-(2,4-difluorophenyl)-7-oxo-N-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide.
| Compound Name | (14aR)-10-(2,4-difluorophenyl)-7-oxo-N-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide |
|---|---|
| PubChem CID | 138990463 |
| Molecular Formula | C26H24F2N4O3 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (14aR)-10-(2,4-difluorophenyl)-7-oxo-N-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonine-2-carboxamide |
| SMILES | O=C1CN2CCN(C(=O)Nc3ccccc3)C[C@@H]2COc2ccc(-c3ccc(F)cc3F)cc2N1 |
| InChI | InChI=1S/C26H24F2N4O3/c27-18-7-8-21(22(28)13-18)17-6-9-24-23(12-17)30-25(33)15-31-10-11-32(14-20(31)16-35-24)26(34)29-19-4-2-1-3-5-19/h1-9,12-13,20H,10-11,14-16H2,(H,29,34)(H,30,33)/t20-/m1/s1 |
| InChIKey | LLIBVVAGUFOJMC-HXUWFJFHSA-N |
| XLogP | 4.18 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |