C27H27N3O3 — CID 138990177
(14aS)-2-(3-methylbenzoyl)-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one (PubChem CID 138990177) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is (14aS)-2-(3-methylbenzoyl)-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one.
| Compound Name | (14aS)-2-(3-methylbenzoyl)-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
|---|---|
| PubChem CID | 138990177 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (14aS)-2-(3-methylbenzoyl)-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
| SMILES | Cc1cccc(C(=O)N2CCN3CC(=O)Nc4cc(-c5ccccc5)ccc4OC[C@@H]3C2)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-19-6-5-9-22(14-19)27(32)30-13-12-29-17-26(31)28-24-15-21(20-7-3-2-4-8-20)10-11-25(24)33-18-23(29)16-30/h2-11,14-15,23H,12-13,16-18H2,1H3,(H,28,31)/t23-/m0/s1 |
| InChIKey | JIEPJGFADVFRDI-QHCPKHFHSA-N |
| XLogP | 3.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |