C23H22N4O3S — CID 138990168
(14aS)-10-phenyl-2-(1,3-thiazole-2-carbonyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one (PubChem CID 138990168) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is (14aS)-10-phenyl-2-(1,3-thiazole-2-carbonyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one.
| Compound Name | (14aS)-10-phenyl-2-(1,3-thiazole-2-carbonyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
|---|---|
| PubChem CID | 138990168 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (14aS)-10-phenyl-2-(1,3-thiazole-2-carbonyl)-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
| SMILES | O=C1CN2CCN(C(=O)c3nccs3)C[C@H]2COc2ccc(-c3ccccc3)cc2N1 |
| InChI | InChI=1S/C23H22N4O3S/c28-21-14-26-9-10-27(23(29)22-24-8-11-31-22)13-18(26)15-30-20-7-6-17(12-19(20)25-21)16-4-2-1-3-5-16/h1-8,11-12,18H,9-10,13-15H2,(H,25,28)/t18-/m0/s1 |
| InChIKey | PHNARWBVSDLABA-SFHVURJKSA-N |
| XLogP | 2.97 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |