C25H24ClN3O4S — CID 138990189
(14aS)-2-(3-chlorophenyl)sulfonyl-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one (PubChem CID 138990189) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is (14aS)-2-(3-chlorophenyl)sulfonyl-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one.
| Compound Name | (14aS)-2-(3-chlorophenyl)sulfonyl-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
|---|---|
| PubChem CID | 138990189 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | (14aS)-2-(3-chlorophenyl)sulfonyl-10-phenyl-3,4,6,8,14,14a-hexahydro-1H-pyrazino[2,1-c][1,4,7]benzoxadiazonin-7-one |
| SMILES | O=C1CN2CCN(S(=O)(=O)c3cccc(Cl)c3)C[C@H]2COc2ccc(-c3ccccc3)cc2N1 |
| InChI | InChI=1S/C25H24ClN3O4S/c26-20-7-4-8-22(14-20)34(31,32)29-12-11-28-16-25(30)27-23-13-19(18-5-2-1-3-6-18)9-10-24(23)33-17-21(28)15-29/h1-10,13-14,21H,11-12,15-17H2,(H,27,30)/t21-/m0/s1 |
| InChIKey | YQLXBDJBSNIQMV-NRFANRHFSA-N |
| XLogP | 3.71 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |