C20H25N7O2 — CID 138992785
1-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 138992785) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 1-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 138992785 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccccc1-n1cccn1)Nc1cnn(CCN2CCOCC2)c1 |
| InChI | InChI=1S/C20H25N7O2/c28-20(21-14-17-4-1-2-5-19(17)27-7-3-6-22-27)24-18-15-23-26(16-18)9-8-25-10-12-29-13-11-25/h1-7,15-16H,8-14H2,(H2,21,24,28) |
| InChIKey | LYIKSZQAPCJVSB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |