C19H27N5O — CID 154748194
1-(1-propylpiperidin-4-yl)-3-[(2-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 154748194) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-(1-propylpiperidin-4-yl)-3-[(2-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-(1-propylpiperidin-4-yl)-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 154748194 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-(1-propylpiperidin-4-yl)-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | CCCN1CCC(NC(=O)NCc2ccccc2-n2cccn2)CC1 |
| InChI | InChI=1S/C19H27N5O/c1-2-11-23-13-8-17(9-14-23)22-19(25)20-15-16-6-3-4-7-18(16)24-12-5-10-21-24/h3-7,10,12,17H,2,8-9,11,13-15H2,1H3,(H2,20,22,25) |
| InChIKey | HVRUHPWZEWCBGD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |