C14H15FN4O — CID 165120008
1-cyclopropyl-3-[(2-fluoro-4-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 165120008) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(2-fluoro-4-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-[(2-fluoro-4-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 165120008 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-cyclopropyl-3-[(2-fluoro-4-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(-n2cccn2)cc1F)NC1CC1 |
| InChI | InChI=1S/C14H15FN4O/c15-13-8-12(19-7-1-6-17-19)5-2-10(13)9-16-14(20)18-11-3-4-11/h1-2,5-8,11H,3-4,9H2,(H2,16,18,20) |
| InChIKey | RVGOLOVRGSANKD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |